2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid

C7H10N2O4 — CID 2386010

IUPAC2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid
SMILESCC1(C)NC(=O)N(CC(=O)O)C1=O
InChIInChI=1S/C7H10N2O4/c1-7(2)5(12)9(3-4(10)11)6(13)8-7/h3H2,1-2H3,(H,8,13)(H,10,11)
InChIKeyUEBZIQDINQDHFR-UHFFFAOYSA-N
MW186.17 g/mol
LogP-0.60
Rot. Bonds2

About 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid

2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid (PubChem CID 2386010) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid
PubChem CID2386010
Molecular FormulaC7H10N2O4
Molecular Weight186.17 g/mol
Exact Mass186.06
IUPAC Name2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid
SMILESCC1(C)NC(=O)N(CC(=O)O)C1=O
InChIInChI=1S/C7H10N2O4/c1-7(2)5(12)9(3-4(10)11)6(13)8-7/h3H2,1-2H3,(H,8,13)(H,10,11)
InChIKeyUEBZIQDINQDHFR-UHFFFAOYSA-N
XLogP-0.60
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.17
LogP ≤ 5-0.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydantoin', 'substructure': 'N/A'}

Analyze 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid?
The IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid (CID 2386010) is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid.
What is the SMILES notation for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid?
The canonical SMILES for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid is CC1(C)NC(=O)N(CC(=O)O)C1=O.
What is the InChIKey of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid?
The InChIKey is UEBZIQDINQDHFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c1-7(2)5(12)9(3-4(10)11)6(13)8-7/h3H2,1-2H3,(H,8,13)(H,10,11).
What are the key properties of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid?
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid has a molecular weight of 186.17 g/mol, XLogP of -0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetic acid is sourced from PubChem (CID 2386010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).