C13H11N5O — CID 2386081
4-phenyl-4,5,7,8,9-pentazatricyclo[7.3.0.02,6]dodeca-1,5,7-trien-3-one (PubChem CID 2386081) has the molecular formula C13H11N5O and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-phenyl-4,5,7,8,9-pentazatricyclo[7.3.0.02,6]dodeca-1,5,7-trien-3-one.
| Compound Name | 4-phenyl-4,5,7,8,9-pentazatricyclo[7.3.0.02,6]dodeca-1,5,7-trien-3-one |
|---|---|
| PubChem CID | 2386081 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-phenyl-4,5,7,8,9-pentazatricyclo[7.3.0.02,6]dodeca-1,5,7-trien-3-one |
| SMILES | O=c1c2c3n(nnc-2nn1-c1ccccc1)CCC3 |
| InChI | InChI=1S/C13H11N5O/c19-13-11-10-7-4-8-17(10)16-14-12(11)15-18(13)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | CJVYYYQFYLMFGO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |