C21H23NO3 — CID 23861838
N-(4-ethoxyphenyl)-2-(4,6,7-trimethyl-1-benzofuran-3-yl)acetamide (PubChem CID 23861838) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(4,6,7-trimethyl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(4,6,7-trimethyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 23861838 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(4,6,7-trimethyl-1-benzofuran-3-yl)acetamide |
| SMILES | CCOc1ccc(NC(=O)Cc2coc3c(C)c(C)cc(C)c23)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-5-24-18-8-6-17(7-9-18)22-19(23)11-16-12-25-21-15(4)13(2)10-14(3)20(16)21/h6-10,12H,5,11H2,1-4H3,(H,22,23) |
| InChIKey | XYNTYOSIGVOFQO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |