C22H26O4 — CID 23862005
(2Z,7Z)-8-[5-(hydroxymethyl)furan-2-yl]-7-phenyl-3-prop-1-en-2-ylocta-2,7-diene-1,4-diol (PubChem CID 23862005) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2Z,7Z)-8-[5-(hydroxymethyl)furan-2-yl]-7-phenyl-3-prop-1-en-2-ylocta-2,7-diene-1,4-diol.
| Compound Name | (2Z,7Z)-8-[5-(hydroxymethyl)furan-2-yl]-7-phenyl-3-prop-1-en-2-ylocta-2,7-diene-1,4-diol |
|---|---|
| PubChem CID | 23862005 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (2Z,7Z)-8-[5-(hydroxymethyl)furan-2-yl]-7-phenyl-3-prop-1-en-2-ylocta-2,7-diene-1,4-diol |
| SMILES | C=C(C)/C(=C/CO)C(O)CC/C(=C/c1ccc(CO)o1)c1ccccc1 |
| InChI | InChI=1S/C22H26O4/c1-16(2)21(12-13-23)22(25)11-8-18(17-6-4-3-5-7-17)14-19-9-10-20(15-24)26-19/h3-7,9-10,12,14,22-25H,1,8,11,13,15H2,2H3/b18-14-,21-12- |
| InChIKey | DBMKNTQSBWTGIC-NGIIAYEMSA-N |
| XLogP | 3.95 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|