C20H26O4S — CID 23862107
4-[(E)-4-[(4R,6aR)-3-methyl-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]-2,6-dimethylphenol (PubChem CID 23862107) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is 4-[(E)-4-[(4R,6aR)-3-methyl-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]-2,6-dimethylphenol.
| Compound Name | 4-[(E)-4-[(4R,6aR)-3-methyl-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 23862107 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-[(E)-4-[(4R,6aR)-3-methyl-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]-2,6-dimethylphenol |
| SMILES | CC1=C2[C@@H](CC/C(C)=C/c3cc(C)c(O)c(C)c3)OC[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C20H26O4S/c1-12(7-16-8-13(2)20(21)14(3)9-16)5-6-17-19-15(4)11-25(22,23)18(19)10-24-17/h7-9,17-18,21H,5-6,10-11H2,1-4H3/b12-7+/t17-,18+/m1/s1 |
| InChIKey | FCLMYIDMNYPHBQ-JVGUAYRASA-N |
| XLogP | 3.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|