C30H35B2NO7 — CID 23862167
[3-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]pentyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]phenyl]boronic acid (PubChem CID 23862167) has the molecular formula C30H35B2NO7 and a molecular weight of 543.23 g/mol. Its IUPAC name is [3-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]pentyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]phenyl]boronic acid.
| Compound Name | [3-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]pentyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23862167 |
| Molecular Formula | C30H35B2NO7 |
| Molecular Weight | 543.23 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | [3-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]pentyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]phenyl]boronic acid |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3ccc(O)cc3)CC)OB(O)C[C@@H]2[C@@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C30H35B2NO7/c1-3-18(14-19-8-11-23(34)12-9-19)10-13-26-27-20(4-2)15-24-28(25(27)17-31(37)40-26)30(36)33(29(24)35)22-7-5-6-21(16-22)32(38)39/h5-9,11-12,14,16,24-26,28,34,37-39H,3-4,10,13,15,17H2,1-2H3/b18-14+/t24-,25+,26-,28-/m1/s1 |
| InChIKey | VBVLTGKOJHDCQQ-ZDRYTIJRSA-N |
| XLogP | 3.06 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|