C24H28ClNO5 — CID 23863005
(1S,2R,3R,6E)-6-[(2-chloro-4-hydroxyphenyl)methylidene]-2-ethenyl-1-(4-nitrophenyl)nonane-1,3-diol (PubChem CID 23863005) has the molecular formula C24H28ClNO5 and a molecular weight of 445.94 g/mol. Its IUPAC name is (1S,2R,3R,6E)-6-[(2-chloro-4-hydroxyphenyl)methylidene]-2-ethenyl-1-(4-nitrophenyl)nonane-1,3-diol.
| Compound Name | (1S,2R,3R,6E)-6-[(2-chloro-4-hydroxyphenyl)methylidene]-2-ethenyl-1-(4-nitrophenyl)nonane-1,3-diol |
|---|---|
| PubChem CID | 23863005 |
| Molecular Formula | C24H28ClNO5 |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (1S,2R,3R,6E)-6-[(2-chloro-4-hydroxyphenyl)methylidene]-2-ethenyl-1-(4-nitrophenyl)nonane-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccc(O)cc1Cl)CCC)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H28ClNO5/c1-3-5-16(14-18-9-12-20(27)15-22(18)25)6-13-23(28)21(4-2)24(29)17-7-10-19(11-8-17)26(30)31/h4,7-12,14-15,21,23-24,27-29H,2-3,5-6,13H2,1H3/b16-14+/t21-,23-,24-/m1/s1 |
| InChIKey | GYUKCQYBEPDYIT-RCRVABRKSA-N |
| XLogP | 5.81 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|