C30H33N3O10 — CID 23863711
[(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(2-methoxy-6-methylphenyl)carbamate (PubChem CID 23863711) has the molecular formula C30H33N3O10 and a molecular weight of 595.61 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(2-methoxy-6-methylphenyl)carbamate.
| Compound Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(2-methoxy-6-methylphenyl)carbamate |
|---|---|
| PubChem CID | 23863711 |
| Molecular Formula | C30H33N3O10 |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(2-methoxy-6-methylphenyl)carbamate |
| SMILES | COc1cccc(C)c1NC(=O)O[C@H]1[C@H](OC(=O)Nc2ccccc2)[C@H](OC(=O)Nc2ccccc2)[C@@H](OC)O[C@@H]1CO |
| InChI | InChI=1S/C30H33N3O10/c1-18-11-10-16-21(38-2)23(18)33-30(37)41-24-22(17-34)40-27(39-3)26(43-29(36)32-20-14-8-5-9-15-20)25(24)42-28(35)31-19-12-6-4-7-13-19/h4-16,22,24-27,34H,17H2,1-3H3,(H,31,35)(H,32,36)(H,33,37)/t22-,24-,25+,26+,27+/m1/s1 |
| InChIKey | SSQIJYDWMNWNOX-OSXMURCFSA-N |
| XLogP | 4.52 |
| TPSA | 162.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|