C23H20F6O4 — CID 23863712
propan-2-yl (2Z)-2-[(2R,6S)-2,6-bis[3-(trifluoromethyl)phenyl]-1,3-dioxan-4-ylidene]acetate (PubChem CID 23863712) has the molecular formula C23H20F6O4 and a molecular weight of 474.40 g/mol. Its IUPAC name is propan-2-yl (2Z)-2-[(2R,6S)-2,6-bis[3-(trifluoromethyl)phenyl]-1,3-dioxan-4-ylidene]acetate.
| Compound Name | propan-2-yl (2Z)-2-[(2R,6S)-2,6-bis[3-(trifluoromethyl)phenyl]-1,3-dioxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 23863712 |
| Molecular Formula | C23H20F6O4 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | propan-2-yl (2Z)-2-[(2R,6S)-2,6-bis[3-(trifluoromethyl)phenyl]-1,3-dioxan-4-ylidene]acetate |
| SMILES | CC(C)OC(=O)/C=C1/C[C@@H](c2cccc(C(F)(F)F)c2)O[C@@H](c2cccc(C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C23H20F6O4/c1-13(2)31-20(30)12-18-11-19(14-5-3-7-16(9-14)22(24,25)26)33-21(32-18)15-6-4-8-17(10-15)23(27,28)29/h3-10,12-13,19,21H,11H2,1-2H3/b18-12-/t19-,21-/m0/s1 |
| InChIKey | LUZKIDVBCVMSIH-YYTVTGCCSA-N |
| XLogP | 6.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|