C21H21FN2O4S — CID 23863719
(2Z)-N-(2,2-dimethoxyethyl)-2-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide (PubChem CID 23863719) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is (2Z)-N-(2,2-dimethoxyethyl)-2-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide.
| Compound Name | (2Z)-N-(2,2-dimethoxyethyl)-2-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 23863719 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2Z)-N-(2,2-dimethoxyethyl)-2-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide |
| SMILES | COC(CNC(=O)/C=C1\Sc2ccccc2N(Cc2ccccc2F)C1=O)OC |
| InChI | InChI=1S/C21H21FN2O4S/c1-27-20(28-2)12-23-19(25)11-18-21(26)24(13-14-7-3-4-8-15(14)22)16-9-5-6-10-17(16)29-18/h3-11,20H,12-13H2,1-2H3,(H,23,25)/b18-11- |
| InChIKey | MNZCBFPXTPGBPX-WQRHYEAKSA-N |
| XLogP | 3.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|