C24H34N4O5 — CID 23863724
(3R,5R,6S,9S)-N-(5-aminopentyl)-6-[3-(2-hydroxyethoxy)phenyl]-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide (PubChem CID 23863724) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is (3R,5R,6S,9S)-N-(5-aminopentyl)-6-[3-(2-hydroxyethoxy)phenyl]-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide.
| Compound Name | (3R,5R,6S,9S)-N-(5-aminopentyl)-6-[3-(2-hydroxyethoxy)phenyl]-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide |
|---|---|
| PubChem CID | 23863724 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (3R,5R,6S,9S)-N-(5-aminopentyl)-6-[3-(2-hydroxyethoxy)phenyl]-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide |
| SMILES | NCCCCCNC(=O)[C@@H]1C[C@@H]2C(=O)N3CCC[C@H]3C(=O)N2[C@@H]1c1cccc(OCCO)c1 |
| InChI | InChI=1S/C24H34N4O5/c25-9-2-1-3-10-26-22(30)18-15-20-23(31)27-11-5-8-19(27)24(32)28(20)21(18)16-6-4-7-17(14-16)33-13-12-29/h4,6-7,14,18-21,29H,1-3,5,8-13,15,25H2,(H,26,30)/t18-,19+,20-,21-/m1/s1 |
| InChIKey | KYHLOEGBLGXRBN-PLACYPQZSA-N |
| XLogP | 0.57 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|