C27H42N5O5+ — CID 23863733
4-[[(3S,6R,7S,8aS)-3-(4-acetamidobutyl)-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carbonyl]amino]butyl-trimethylazanium (PubChem CID 23863733) has the molecular formula C27H42N5O5+ and a molecular weight of 516.66 g/mol. Its IUPAC name is 4-[[(3S,6R,7S,8aS)-3-(4-acetamidobutyl)-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carbonyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[[(3S,6R,7S,8aS)-3-(4-acetamidobutyl)-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carbonyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 23863733 |
| Molecular Formula | C27H42N5O5+ |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | 4-[[(3S,6R,7S,8aS)-3-(4-acetamidobutyl)-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carbonyl]amino]butyl-trimethylazanium |
| SMILES | CC(=O)NCCCC[C@@H]1NC(=O)[C@@H]2C[C@H](C(=O)NCCCC[N+](C)(C)C)[C@H](c3ccc(O)cc3)N2C1=O |
| InChI | InChI=1S/C27H41N5O5/c1-18(33)28-14-6-5-9-22-27(37)31-23(26(36)30-22)17-21(24(31)19-10-12-20(34)13-11-19)25(35)29-15-7-8-16-32(2,3)4/h10-13,21-24H,5-9,14-17H2,1-4H3,(H3-,28,29,30,33,34,35,36)/p+1/t21-,22-,23-,24-/m0/s1 |
| InChIKey | PIFYBJQVXLOVIG-ZJZGAYNASA-O |
| XLogP | 1.06 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|