C24H35N4O4+ — CID 23863739
4-[[(3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carbonyl]amino]butyl-trimethylazanium (PubChem CID 23863739) has the molecular formula C24H35N4O4+ and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-[[(3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carbonyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[[(3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carbonyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 23863739 |
| Molecular Formula | C24H35N4O4+ |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 4-[[(3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carbonyl]amino]butyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCCNC(=O)[C@H]1C[C@H]2C(=O)N3CCC[C@H]3C(=O)N2[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C24H34N4O4/c1-28(2,3)14-5-4-12-25-22(30)18-15-20-23(31)26-13-6-7-19(26)24(32)27(20)21(18)16-8-10-17(29)11-9-16/h8-11,18-21H,4-7,12-15H2,1-3H3,(H-,25,29,30)/p+1/t18-,19-,20-,21-/m0/s1 |
| InChIKey | LOBOCHFWHSQCFQ-TUFLPTIASA-O |
| XLogP | 1.26 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|