C26H37N3O6 — CID 23864495
(2R,4R)-2-(4-hydroxybutoxy)-N-(6-hydroxyhexyl)-4-(2-methyl-5-oxo-1-phenylpyrazol-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23864495) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is (2R,4R)-2-(4-hydroxybutoxy)-N-(6-hydroxyhexyl)-4-(2-methyl-5-oxo-1-phenylpyrazol-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-2-(4-hydroxybutoxy)-N-(6-hydroxyhexyl)-4-(2-methyl-5-oxo-1-phenylpyrazol-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23864495 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | (2R,4R)-2-(4-hydroxybutoxy)-N-(6-hydroxyhexyl)-4-(2-methyl-5-oxo-1-phenylpyrazol-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Cn1c([C@H]2C=C(C(=O)NCCCCCCO)O[C@@H](OCCCCO)C2)cc(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C26H37N3O6/c1-28-22(19-24(32)29(28)21-11-5-4-6-12-21)20-17-23(26(33)27-13-7-2-3-8-14-30)35-25(18-20)34-16-10-9-15-31/h4-6,11-12,17,19-20,25,30-31H,2-3,7-10,13-16,18H2,1H3,(H,27,33)/t20-,25+/m0/s1 |
| InChIKey | UVZRJXDEKWSXTM-NBGIEHNGSA-N |
| XLogP | 2.35 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|