About (2-phenyl-1,3-thiazol-4-yl)methyl benzoate
(2-phenyl-1,3-thiazol-4-yl)methyl benzoate (PubChem CID 2386621) has the molecular formula C17H13NO2S
and a molecular weight of 295.36 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl benzoate.
Molecular Properties
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl benzoate |
| PubChem CID | 2386621 |
| Molecular Formula | C17H13NO2S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl benzoate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H13NO2S/c19-17(14-9-5-2-6-10-14)20-11-15-12-21-16(18-15)13-7-3-1-4-8-13/h1-10,12H,11H2 |
| InChIKey | DRQNECIODIELAJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-phenyl-1,3-thiazol-4-yl)methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl benzoate?
The IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl benzoate (CID 2386621) is (2-phenyl-1,3-thiazol-4-yl)methyl benzoate.
What is the SMILES notation for (2-phenyl-1,3-thiazol-4-yl)methyl benzoate?
The canonical SMILES for (2-phenyl-1,3-thiazol-4-yl)methyl benzoate is O=C(OCc1csc(-c2ccccc2)n1)c1ccccc1.
What is the InChIKey of (2-phenyl-1,3-thiazol-4-yl)methyl benzoate?
The InChIKey is DRQNECIODIELAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2S/c19-17(14-9-5-2-6-10-14)20-11-15-12-21-16(18-15)13-7-3-1-4-8-13/h1-10,12H,11H2.
What are the key properties of (2-phenyl-1,3-thiazol-4-yl)methyl benzoate?
(2-phenyl-1,3-thiazol-4-yl)methyl benzoate has a molecular weight of 295.36 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-thiazol-4-yl)methyl benzoate is sourced from PubChem (CID 2386621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).