C26H36N2O6 — CID 23866593
ethyl (5R,6R,7R)-2-[(2,6-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23866593) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is ethyl (5R,6R,7R)-2-[(2,6-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6R,7R)-2-[(2,6-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23866593 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | ethyl (5R,6R,7R)-2-[(2,6-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)CC(C)C)C(C(=O)Nc3c(C)cccc3C)C23CC[C@H]1O3 |
| InChI | InChI=1S/C26H36N2O6/c1-6-33-25(32)19-18-10-11-26(34-18)20(19)24(31)28(17(13-29)12-14(2)3)22(26)23(30)27-21-15(4)8-7-9-16(21)5/h7-9,14,17-20,22,29H,6,10-13H2,1-5H3,(H,27,30)/t17-,18-,19+,20+,22?,26?/m1/s1 |
| InChIKey | ZCNNYFZKMWUFQP-MJIRAMFJSA-N |
| XLogP | 2.59 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |