C36H44N2O5S — CID 23867535
hex-5-enyl (5S,6R,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23867535) has the molecular formula C36H44N2O5S and a molecular weight of 616.82 g/mol. Its IUPAC name is hex-5-enyl (5S,6R,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6R,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23867535 |
| Molecular Formula | C36H44N2O5S |
| Molecular Weight | 616.82 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | hex-5-enyl (5S,6R,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@H]2C(=O)N([C@H](CO)c3ccccc3)C(C(=O)N(CC=C)c3c(C)cccc3C)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C36H44N2O5S/c1-6-8-9-13-22-43-34(42)29-28-32(40)38(27(23-39)26-17-11-10-12-18-26)31(36(28)20-19-35(29,5)44-36)33(41)37(21-7-2)30-24(3)15-14-16-25(30)4/h6-7,10-12,14-18,27-29,31,39H,1-2,8-9,13,19-23H2,3-5H3/t27-,28+,29-,31?,35+,36?/m1/s1 |
| InChIKey | XRJMCAHIDFCLOD-UNGIMTDCSA-N |
| XLogP | 5.94 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.82 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|