About methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate
methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate (PubChem CID 2386802) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate.
Molecular Properties
| Compound Name | methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate |
| PubChem CID | 2386802 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate |
| SMILES | COC(=O)NNC1=CC(C)(C)C[C@H](C)C1 |
| InChI | InChI=1S/C11H20N2O2/c1-8-5-9(7-11(2,3)6-8)12-13-10(14)15-4/h7-8,12H,5-6H2,1-4H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | OLDOPBZKRRNHOD-MRVPVSSYSA-N |
| XLogP | 2.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate?
The IUPAC name of methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate (CID 2386802) is methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate.
What is the SMILES notation for methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate?
The canonical SMILES for methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate is COC(=O)NNC1=CC(C)(C)C[C@H](C)C1.
What is the InChIKey of methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate?
The InChIKey is OLDOPBZKRRNHOD-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-8-5-9(7-11(2,3)6-8)12-13-10(14)15-4/h7-8,12H,5-6H2,1-4H3,(H,13,14)/t8-/m1/s1.
What are the key properties of methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate?
methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate has a molecular weight of 212.29 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[[(5S)-3,3,5-trimethylcyclohexen-1-yl]amino]carbamate is sourced from PubChem (CID 2386802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).