C28H36ClN3O5 — CID 23868277
(5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-7-ethyl-3-(2-hydroxyethyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868277) has the molecular formula C28H36ClN3O5 and a molecular weight of 530.07 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-7-ethyl-3-(2-hydroxyethyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-7-ethyl-3-(2-hydroxyethyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868277 |
| Molecular Formula | C28H36ClN3O5 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | (5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-7-ethyl-3-(2-hydroxyethyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)c3c(C)cccc3Cl)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C28H36ClN3O5/c1-6-14-30(5)24(34)20-21-25(35)32(16-17-33)23(28(21)13-12-27(20,8-3)37-28)26(36)31(15-7-2)22-18(4)10-9-11-19(22)29/h6-7,9-11,20-21,23,33H,1-2,8,12-17H2,3-5H3/t20-,21+,23?,27+,28?/m1/s1 |
| InChIKey | UAFWPPSLKQHUBV-OEJMUSALSA-N |
| XLogP | 2.96 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|