About [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate (PubChem CID 2386883) has the molecular formula C21H24N2O3
and a molecular weight of 352.43 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate.
Molecular Properties
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate |
| PubChem CID | 2386883 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)OCC(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-3-22(4-2)18-11-9-17(10-12-18)21(25)26-15-20(24)23-14-13-16-7-5-6-8-19(16)23/h5-12H,3-4,13-15H2,1-2H3 |
| InChIKey | ODJOYGNYVUGMJY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate?
The IUPAC name of [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate (CID 2386883) is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate.
What is the SMILES notation for [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate?
The canonical SMILES for [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate is CCN(CC)c1ccc(C(=O)OCC(=O)N2CCc3ccccc32)cc1.
What is the InChIKey of [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate?
The InChIKey is ODJOYGNYVUGMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3/c1-3-22(4-2)18-11-9-17(10-12-18)21(25)26-15-20(24)23-14-13-16-7-5-6-8-19(16)23/h5-12H,3-4,13-15H2,1-2H3.
What are the key properties of [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate?
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate has a molecular weight of 352.43 g/mol, XLogP of 3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(diethylamino)benzoate is sourced from PubChem (CID 2386883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).