C22H28N2O7 — CID 23871248
ethyl (1R,2R,5S,6S,7S)-3-(3-hydroxypropyl)-2-[(4-methoxyphenyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23871248) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,7S)-3-(3-hydroxypropyl)-2-[(4-methoxyphenyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,7S)-3-(3-hydroxypropyl)-2-[(4-methoxyphenyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23871248 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | ethyl (1R,2R,5S,6S,7S)-3-(3-hydroxypropyl)-2-[(4-methoxyphenyl)carbamoyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CC[C@]3(O2)[C@H](C(=O)Nc2ccc(OC)cc2)N(CCCO)C(=O)[C@@H]13 |
| InChI | InChI=1S/C22H28N2O7/c1-3-30-21(28)16-15-9-10-22(31-15)17(16)20(27)24(11-4-12-25)18(22)19(26)23-13-5-7-14(29-2)8-6-13/h5-8,15-18,25H,3-4,9-12H2,1-2H3,(H,23,26)/t15-,16+,17+,18-,22+/m0/s1 |
| InChIKey | KZPIZYPNYZIFPC-IUHXOWBESA-N |
| XLogP | 0.95 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |