C26H24O4 — CID 23872055
1-[4-[(2R,3S,6S)-2-(hydroxymethyl)-3-(4-phenylphenoxy)-3,6-dihydro-2H-pyran-6-yl]phenyl]ethanone (PubChem CID 23872055) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-[4-[(2R,3S,6S)-2-(hydroxymethyl)-3-(4-phenylphenoxy)-3,6-dihydro-2H-pyran-6-yl]phenyl]ethanone.
| Compound Name | 1-[4-[(2R,3S,6S)-2-(hydroxymethyl)-3-(4-phenylphenoxy)-3,6-dihydro-2H-pyran-6-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 23872055 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-[4-[(2R,3S,6S)-2-(hydroxymethyl)-3-(4-phenylphenoxy)-3,6-dihydro-2H-pyran-6-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc([C@@H]2C=C[C@H](Oc3ccc(-c4ccccc4)cc3)[C@@H](CO)O2)cc1 |
| InChI | InChI=1S/C26H24O4/c1-18(28)19-7-9-22(10-8-19)24-15-16-25(26(17-27)30-24)29-23-13-11-21(12-14-23)20-5-3-2-4-6-20/h2-16,24-27H,17H2,1H3/t24-,25-,26+/m0/s1 |
| InChIKey | RHEUMQFNOLHRJN-KKUQBAQOSA-N |
| XLogP | 4.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|