C20H36O2 — CID 23872105
(1S,2S,8aR)-1-[(Z)-5-hydroxy-3-methylpent-3-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 23872105) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (1S,2S,8aR)-1-[(Z)-5-hydroxy-3-methylpent-3-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1S,2S,8aR)-1-[(Z)-5-hydroxy-3-methylpent-3-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 23872105 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (1S,2S,8aR)-1-[(Z)-5-hydroxy-3-methylpent-3-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | C/C(=C/CO)CC[C@@H]1[C@@](C)(O)CCC2C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H36O2/c1-15(10-14-21)7-8-17-19(4)12-6-11-18(2,3)16(19)9-13-20(17,5)22/h10,16-17,21-22H,6-9,11-14H2,1-5H3/b15-10-/t16?,17-,19+,20-/m0/s1 |
| InChIKey | LEOHDQKUMQKLMP-NDXZNEAXSA-N |
| XLogP | 4.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|