C28H33N4O8P — CID 23872224
(3Z)-3-dimethoxyphosphorylimino-7-methoxy-2-[(5-nitrofuran-2-yl)methyl]-1-[4-(pyrrolidin-1-ylmethyl)phenyl]-1,4-dihydroisoquinolin-6-ol (PubChem CID 23872224) has the molecular formula C28H33N4O8P and a molecular weight of 584.57 g/mol. Its IUPAC name is (3Z)-3-dimethoxyphosphorylimino-7-methoxy-2-[(5-nitrofuran-2-yl)methyl]-1-[4-(pyrrolidin-1-ylmethyl)phenyl]-1,4-dihydroisoquinolin-6-ol.
| Compound Name | (3Z)-3-dimethoxyphosphorylimino-7-methoxy-2-[(5-nitrofuran-2-yl)methyl]-1-[4-(pyrrolidin-1-ylmethyl)phenyl]-1,4-dihydroisoquinolin-6-ol |
|---|---|
| PubChem CID | 23872224 |
| Molecular Formula | C28H33N4O8P |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | (3Z)-3-dimethoxyphosphorylimino-7-methoxy-2-[(5-nitrofuran-2-yl)methyl]-1-[4-(pyrrolidin-1-ylmethyl)phenyl]-1,4-dihydroisoquinolin-6-ol |
| SMILES | COc1cc2c(cc1O)C/C(=N/P(=O)(OC)OC)N(Cc1ccc([N+](=O)[O-])o1)C2c1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C28H33N4O8P/c1-37-25-16-23-21(14-24(25)33)15-26(29-41(36,38-2)39-3)31(18-22-10-11-27(40-22)32(34)35)28(23)20-8-6-19(7-9-20)17-30-12-4-5-13-30/h6-11,14,16,28,33H,4-5,12-13,15,17-18H2,1-3H3/b29-26- |
| InChIKey | MVKBGHZOLPLYTH-WCTVFOPTSA-N |
| XLogP | 5.44 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|