About [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone
[1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone (PubChem CID 2387252) has the molecular formula C16H13FN4O2
and a molecular weight of 312.30 g/mol. Its IUPAC name is [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone |
| PubChem CID | 2387252 |
| Molecular Formula | C16H13FN4O2 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone |
| SMILES | Cc1cc(C)nc(-n2cc(C(=O)c3cc(F)ccc3O)cn2)n1 |
| InChI | InChI=1S/C16H13FN4O2/c1-9-5-10(2)20-16(19-9)21-8-11(7-18-21)15(23)13-6-12(17)3-4-14(13)22/h3-8,22H,1-2H3 |
| InChIKey | OUPHHIYACUSWCF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone?
The IUPAC name of [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone (CID 2387252) is [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone.
What is the SMILES notation for [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone?
The canonical SMILES for [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone is Cc1cc(C)nc(-n2cc(C(=O)c3cc(F)ccc3O)cn2)n1.
What is the InChIKey of [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone?
The InChIKey is OUPHHIYACUSWCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN4O2/c1-9-5-10(2)20-16(19-9)21-8-11(7-18-21)15(23)13-6-12(17)3-4-14(13)22/h3-8,22H,1-2H3.
What are the key properties of [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone?
[1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone has a molecular weight of 312.30 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4,6-dimethylpyrimidin-2-yl)pyrazol-4-yl]-(5-fluoro-2-hydroxyphenyl)methanone is sourced from PubChem (CID 2387252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).