C29H36FN5O5Si — CID 23872625
(2S)-N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide (PubChem CID 23872625) has the molecular formula C29H36FN5O5Si and a molecular weight of 581.72 g/mol. Its IUPAC name is (2S)-N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide.
| Compound Name | (2S)-N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 23872625 |
| Molecular Formula | C29H36FN5O5Si |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | (2S)-N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3'-methyl-2-oxo-1-phenylspiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide |
| SMILES | C[C@H](O)C(=O)Nc1ccc2c(c1)[C@]1(O[C@@H](CCn3cc(CCO)nn3)[C@H]([Si](C)(C)F)[C@H]1C)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C29H36FN5O5Si/c1-18-26(41(3,4)30)25(12-14-34-17-21(13-15-36)32-33-34)40-29(18)23-16-20(31-27(38)19(2)37)10-11-24(23)35(28(29)39)22-8-6-5-7-9-22/h5-11,16-19,25-26,36-37H,12-15H2,1-4H3,(H,31,38)/t18-,19+,25+,26-,29+/m1/s1 |
| InChIKey | SMRUXIIUQQACSA-FBBPBQLRSA-N |
| XLogP | 3.68 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|