About 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine
2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine (PubChem CID 23872665) has the molecular formula C15H15Cl2N2+
and a molecular weight of 294.21 g/mol. Its IUPAC name is 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
| PubChem CID | 23872665 |
| Molecular Formula | C15H15Cl2N2+ |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
| SMILES | NCC[n+]1ccccc1/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N2/c16-14-7-5-12(11-15(14)17)4-6-13-3-1-2-9-19(13)10-8-18/h1-7,9,11H,8,10,18H2/q+1/b6-4+ |
| InChIKey | MMLGUFATAFNSOX-GQCTYLIASA-N |
| XLogP | 3.41 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine?
The IUPAC name of 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine (CID 23872665) is 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine.
What is the SMILES notation for 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine?
The canonical SMILES for 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine is NCC[n+]1ccccc1/C=C/c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine?
The InChIKey is MMLGUFATAFNSOX-GQCTYLIASA-N. The full InChI is InChI=1S/C15H15Cl2N2/c16-14-7-5-12(11-15(14)17)4-6-13-3-1-2-9-19(13)10-8-18/h1-7,9,11H,8,10,18H2/q+1/b6-4+.
What are the key properties of 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine?
2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine has a molecular weight of 294.21 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(E)-2-(3,4-dichlorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine is sourced from PubChem (CID 23872665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).