About 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine
6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine (PubChem CID 23872682) has the molecular formula C24H24N2O2
and a molecular weight of 372.47 g/mol. Its IUPAC name is 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine.
Molecular Properties
| Compound Name | 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine |
| PubChem CID | 23872682 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine |
| SMILES | [H]/N=c1\ccc2c(-c3cc(C)c(OC)c(C)c3)c3ccc(N(C)C)cc3oc-2c1 |
| InChI | InChI=1S/C24H24N2O2/c1-14-10-16(11-15(2)24(14)27-5)23-19-8-6-17(25)12-21(19)28-22-13-18(26(3)4)7-9-20(22)23/h6-13,25H,1-5H3/b25-17+ |
| InChIKey | WGCGHZHPRWLQND-KOEQRZSOSA-N |
| XLogP | 5.38 |
| TPSA | 49.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine?
The IUPAC name of 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine (CID 23872682) is 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine.
What is the SMILES notation for 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine?
The canonical SMILES for 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine is [H]/N=c1\ccc2c(-c3cc(C)c(OC)c(C)c3)c3ccc(N(C)C)cc3oc-2c1.
What is the InChIKey of 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine?
The InChIKey is WGCGHZHPRWLQND-KOEQRZSOSA-N. The full InChI is InChI=1S/C24H24N2O2/c1-14-10-16(11-15(2)24(14)27-5)23-19-8-6-17(25)12-21(19)28-22-13-18(26(3)4)7-9-20(22)23/h6-13,25H,1-5H3/b25-17+.
What are the key properties of 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine?
6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine has a molecular weight of 372.47 g/mol, XLogP of 5.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-9-(4-methoxy-3,5-dimethylphenyl)-N,N-dimethylxanthen-3-amine is sourced from PubChem (CID 23872682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).