C8H12N2O3 — CID 23873
5-ethyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 23873) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-ethyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23873 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-ethyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C8H12N2O3/c1-4-5-6(11)9(2)8(13)10(3)7(5)12/h5H,4H2,1-3H3 |
| InChIKey | QBCQXNDNMOHQIU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|