About (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate
(2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate (PubChem CID 2387444) has the molecular formula C13H12ClF2NO3
and a molecular weight of 303.69 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate.
Molecular Properties
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate |
| PubChem CID | 2387444 |
| Molecular Formula | C13H12ClF2NO3 |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(OCC(=O)N1CCCC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H12ClF2NO3/c14-9-6-11(16)10(15)5-8(9)13(19)20-7-12(18)17-3-1-2-4-17/h5-6H,1-4,7H2 |
| InChIKey | VKENLBWGTOQAIH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate?
The IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate (CID 2387444) is (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate.
What is the SMILES notation for (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate?
The canonical SMILES for (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate is O=C(OCC(=O)N1CCCC1)c1cc(F)c(F)cc1Cl.
What is the InChIKey of (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate?
The InChIKey is VKENLBWGTOQAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClF2NO3/c14-9-6-11(16)10(15)5-8(9)13(19)20-7-12(18)17-3-1-2-4-17/h5-6H,1-4,7H2.
What are the key properties of (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate?
(2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate has a molecular weight of 303.69 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-2-pyrrolidin-1-ylethyl) 2-chloro-4,5-difluorobenzoate is sourced from PubChem (CID 2387444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).