C27H27BrN4O6 — CID 23874924
(2S,4S)-4-(4-bromophenyl)-2-[[4-(hydroxymethyl)phenyl]methoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23874924) has the molecular formula C27H27BrN4O6 and a molecular weight of 583.44 g/mol. Its IUPAC name is (2S,4S)-4-(4-bromophenyl)-2-[[4-(hydroxymethyl)phenyl]methoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-4-(4-bromophenyl)-2-[[4-(hydroxymethyl)phenyl]methoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23874924 |
| Molecular Formula | C27H27BrN4O6 |
| Molecular Weight | 583.44 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | (2S,4S)-4-(4-bromophenyl)-2-[[4-(hydroxymethyl)phenyl]methoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCCNc1ccc([N+](=O)[O-])cn1)C1=C[C@@H](c2ccc(Br)cc2)C[C@@H](OCc2ccc(CO)cc2)O1 |
| InChI | InChI=1S/C27H27BrN4O6/c28-22-7-5-20(6-8-22)21-13-24(38-26(14-21)37-17-19-3-1-18(16-33)2-4-19)27(34)30-12-11-29-25-10-9-23(15-31-25)32(35)36/h1-10,13,15,21,26,33H,11-12,14,16-17H2,(H,29,31)(H,30,34)/t21-,26+/m1/s1 |
| InChIKey | SNYLCMDFQJEKCN-RLWLMLJZSA-N |
| XLogP | 4.40 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|