C24H27F3N4O6 — CID 23874947
(2S,4S)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23874947) has the molecular formula C24H27F3N4O6 and a molecular weight of 524.50 g/mol. Its IUPAC name is (2S,4S)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23874947 |
| Molecular Formula | C24H27F3N4O6 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (2S,4S)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCCNc1ccc([N+](=O)[O-])cn1)C1=C[C@@H](c2ccc(C(F)(F)F)cc2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C24H27F3N4O6/c25-24(26,27)18-5-3-16(4-6-18)17-13-20(37-22(14-17)36-12-2-1-11-32)23(33)29-10-9-28-21-8-7-19(15-30-21)31(34)35/h3-8,13,15,17,22,32H,1-2,9-12,14H2,(H,28,30)(H,29,33)/t17-,22+/m1/s1 |
| InChIKey | JNTNQHFLCZSHIU-VGSWGCGISA-N |
| XLogP | 3.74 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|