C23H19NO2 — CID 23875612
11-(4-methylphenyl)-7,8,10a,11-tetrahydro-6H-indeno[1,2-b]quinoline-9,10-dione (PubChem CID 23875612) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 11-(4-methylphenyl)-7,8,10a,11-tetrahydro-6H-indeno[1,2-b]quinoline-9,10-dione.
| Compound Name | 11-(4-methylphenyl)-7,8,10a,11-tetrahydro-6H-indeno[1,2-b]quinoline-9,10-dione |
|---|---|
| PubChem CID | 23875612 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 11-(4-methylphenyl)-7,8,10a,11-tetrahydro-6H-indeno[1,2-b]quinoline-9,10-dione |
| SMILES | Cc1ccc(C2c3ccccc3C3=NC4=C(C(=O)CCC4)C(=O)C32)cc1 |
| InChI | InChI=1S/C23H19NO2/c1-13-9-11-14(12-10-13)19-15-5-2-3-6-16(15)22-21(19)23(26)20-17(24-22)7-4-8-18(20)25/h2-3,5-6,9-12,19,21H,4,7-8H2,1H3 |
| InChIKey | NSVFILMHYOHZAR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|