C26H23NO3S — CID 23876539
ethyl 2-(anthracene-9-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23876539) has the molecular formula C26H23NO3S and a molecular weight of 429.54 g/mol. Its IUPAC name is ethyl 2-(anthracene-9-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-(anthracene-9-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23876539 |
| Molecular Formula | C26H23NO3S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | ethyl 2-(anthracene-9-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2c3ccccc3cc3ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C26H23NO3S/c1-2-30-26(29)23-20-13-7-8-14-21(20)31-25(23)27-24(28)22-18-11-5-3-9-16(18)15-17-10-4-6-12-19(17)22/h3-6,9-12,15H,2,7-8,13-14H2,1H3,(H,27,28) |
| InChIKey | AOUFSNBMWBLTEG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|