C22H22N4O4S — CID 23876639
1-methyl-3-[[2-methylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]imino]indol-2-one (PubChem CID 23876639) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 1-methyl-3-[[2-methylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]imino]indol-2-one.
| Compound Name | 1-methyl-3-[[2-methylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]imino]indol-2-one |
|---|---|
| PubChem CID | 23876639 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1-methyl-3-[[2-methylimino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]imino]indol-2-one |
| SMILES | C/N=c1\scc(-c2cc(OC)c(OC)c(OC)c2)n1N=C1C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C22H22N4O4S/c1-23-22-26(24-19-14-8-6-7-9-15(14)25(2)21(19)27)16(12-31-22)13-10-17(28-3)20(30-5)18(11-13)29-4/h6-12H,1-5H3/b23-22-,24-19? |
| InChIKey | CPDKRODUGACWFO-PDFNOZGGSA-N |
| XLogP | 3.00 |
| TPSA | 77.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|