C13H18N4O — CID 23877704
2-(ethylamino)-6,7,8,9-tetramethylpyrido[1,2-a][1,3,5]triazin-4-one (PubChem CID 23877704) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(ethylamino)-6,7,8,9-tetramethylpyrido[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-(ethylamino)-6,7,8,9-tetramethylpyrido[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 23877704 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-(ethylamino)-6,7,8,9-tetramethylpyrido[1,2-a][1,3,5]triazin-4-one |
| SMILES | CCNc1nc(=O)n2c(C)c(C)c(C)c(C)c2n1 |
| InChI | InChI=1S/C13H18N4O/c1-6-14-12-15-11-9(4)7(2)8(3)10(5)17(11)13(18)16-12/h6H2,1-5H3,(H,14,16,18) |
| InChIKey | QBOHBPZMWFVRHH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |