C9H8N6O3S — CID 23878026
N-(4-formamido-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 23878026) has the molecular formula C9H8N6O3S and a molecular weight of 280.27 g/mol. Its IUPAC name is N-(4-formamido-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide.
| Compound Name | N-(4-formamido-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 23878026 |
| Molecular Formula | C9H8N6O3S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-(4-formamido-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | O=CNc1nonc1NC(=O)CSc1ncccn1 |
| InChI | InChI=1S/C9H8N6O3S/c16-5-12-7-8(15-18-14-7)13-6(17)4-19-9-10-2-1-3-11-9/h1-3,5H,4H2,(H,12,14,16)(H,13,15,17) |
| InChIKey | IPIVIEXPTBFXLG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|