C21H14F2N2OS — CID 23878433
2-benzylsulfanyl-3-(3,4-difluorophenyl)quinazolin-4-one (PubChem CID 23878433) has the molecular formula C21H14F2N2OS and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-benzylsulfanyl-3-(3,4-difluorophenyl)quinazolin-4-one.
| Compound Name | 2-benzylsulfanyl-3-(3,4-difluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 23878433 |
| Molecular Formula | C21H14F2N2OS |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-benzylsulfanyl-3-(3,4-difluorophenyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2ccccc2)n1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H14F2N2OS/c22-17-11-10-15(12-18(17)23)25-20(26)16-8-4-5-9-19(16)24-21(25)27-13-14-6-2-1-3-7-14/h1-12H,13H2 |
| InChIKey | LRKSMXXSBVSFNP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |