C16H15ClN2O3S — CID 23878603
ethyl 4-(4-chlorophenyl)-2-oxo-5-sulfanylidene-1,3,4,7-tetrahydropyrrolo[3,4-b]pyridine-6-carboxylate (PubChem CID 23878603) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-oxo-5-sulfanylidene-1,3,4,7-tetrahydropyrrolo[3,4-b]pyridine-6-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-oxo-5-sulfanylidene-1,3,4,7-tetrahydropyrrolo[3,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 23878603 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-oxo-5-sulfanylidene-1,3,4,7-tetrahydropyrrolo[3,4-b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)N1CC2=C(C1=S)C(c1ccc(Cl)cc1)CC(=O)N2 |
| InChI | InChI=1S/C16H15ClN2O3S/c1-2-22-16(21)19-8-12-14(15(19)23)11(7-13(20)18-12)9-3-5-10(17)6-4-9/h3-6,11H,2,7-8H2,1H3,(H,18,20) |
| InChIKey | GVMHSWLUKJTGEZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|