About 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine
6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine (PubChem CID 23880235) has the molecular formula C14H13NS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine.
Molecular Properties
| Compound Name | 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine |
| PubChem CID | 23880235 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine |
| SMILES | CC1Nc2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C14H13NS/c1-10-11-6-2-4-8-13(11)16-14-9-5-3-7-12(14)15-10/h2-10,15H,1H3 |
| InChIKey | SOEOQZDCAQAIMO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine?
The IUPAC name of 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine (CID 23880235) is 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine.
What is the SMILES notation for 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine?
The canonical SMILES for 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine is CC1Nc2ccccc2Sc2ccccc21.
What is the InChIKey of 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine?
The InChIKey is SOEOQZDCAQAIMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NS/c1-10-11-6-2-4-8-13(11)16-14-9-5-3-7-12(14)15-10/h2-10,15H,1H3.
What are the key properties of 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine?
6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine has a molecular weight of 227.33 g/mol, XLogP of 4.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,6-dihydrobenzo[b][1,4]benzothiazepine is sourced from PubChem (CID 23880235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).