C27H28N2O6 — CID 23881034
methyl 2,7,7-trimethyl-4-[4-[(4-nitrophenyl)methoxy]phenyl]-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 23881034) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is methyl 2,7,7-trimethyl-4-[4-[(4-nitrophenyl)methoxy]phenyl]-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | methyl 2,7,7-trimethyl-4-[4-[(4-nitrophenyl)methoxy]phenyl]-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 23881034 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | methyl 2,7,7-trimethyl-4-[4-[(4-nitrophenyl)methoxy]phenyl]-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)CC(C)(C)C2)C1c1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H28N2O6/c1-16-23(26(31)34-4)24(25-21(28-16)13-27(2,3)14-22(25)30)18-7-11-20(12-8-18)35-15-17-5-9-19(10-6-17)29(32)33/h5-12,24,28H,13-15H2,1-4H3 |
| InChIKey | PTMJJJDFFUZSGN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|