C24H25N3O5S — CID 23881284
ethyl 4-[4-(naphthalen-1-ylcarbamoyl)phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 23881284) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is ethyl 4-[4-(naphthalen-1-ylcarbamoyl)phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(naphthalen-1-ylcarbamoyl)phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 23881284 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | ethyl 4-[4-(naphthalen-1-ylcarbamoyl)phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccc(C(=O)Nc3cccc4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C24H25N3O5S/c1-2-32-24(29)26-14-16-27(17-15-26)33(30,31)20-12-10-19(11-13-20)23(28)25-22-9-5-7-18-6-3-4-8-21(18)22/h3-13H,2,14-17H2,1H3,(H,25,28) |
| InChIKey | JREADVAOAHQOQO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |