C25H38NO2+ — CID 23881760
1-benzyl-1-[[2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxolan-4-yl]methyl]piperidin-1-ium (PubChem CID 23881760) has the molecular formula C25H38NO2+ and a molecular weight of 384.58 g/mol. Its IUPAC name is 1-benzyl-1-[[2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxolan-4-yl]methyl]piperidin-1-ium.
| Compound Name | 1-benzyl-1-[[2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 23881760 |
| Molecular Formula | C25H38NO2+ |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 1-benzyl-1-[[2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
| SMILES | CC1=CC(C)C(C2OCC(C[N+]3(Cc4ccccc4)CCCCC3)O2)C(C)C1 |
| InChI | InChI=1S/C25H38NO2/c1-19-14-20(2)24(21(3)15-19)25-27-18-23(28-25)17-26(12-8-5-9-13-26)16-22-10-6-4-7-11-22/h4,6-7,10-11,14,20-21,23-25H,5,8-9,12-13,15-18H2,1-3H3/q+1 |
| InChIKey | PORVWFSZEHIALM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|