C23H26N2O5S — CID 23882744
ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-5-methylhexanoyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 23882744) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-5-methylhexanoyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-5-methylhexanoyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 23882744 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-5-methylhexanoyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)C(CCC(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H26N2O5S/c1-5-30-23(29)17-12-14(4)31-20(17)24-19(26)18(11-10-13(2)3)25-21(27)15-8-6-7-9-16(15)22(25)28/h6-9,12-13,18H,5,10-11H2,1-4H3,(H,24,26) |
| InChIKey | QKTNPADYEBOBQE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|