C24H21FN2O3S — CID 23883734
(4-propylphenyl) 3-[(2-fluorophenyl)methyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23883734) has the molecular formula C24H21FN2O3S and a molecular weight of 436.51 g/mol. Its IUPAC name is (4-propylphenyl) 3-[(2-fluorophenyl)methyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | (4-propylphenyl) 3-[(2-fluorophenyl)methyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23883734 |
| Molecular Formula | C24H21FN2O3S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (4-propylphenyl) 3-[(2-fluorophenyl)methyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCCc1ccc(OC(=O)c2sc3ncn(Cc4ccccc4F)c(=O)c3c2C)cc1 |
| InChI | InChI=1S/C24H21FN2O3S/c1-3-6-16-9-11-18(12-10-16)30-24(29)21-15(2)20-22(31-21)26-14-27(23(20)28)13-17-7-4-5-8-19(17)25/h4-5,7-12,14H,3,6,13H2,1-2H3 |
| InChIKey | WKMCFSLXJFNURE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|