About methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate
methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate (PubChem CID 23884185) has the molecular formula C28H30N2O5S
and a molecular weight of 506.62 g/mol. Its IUPAC name is methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate |
| PubChem CID | 23884185 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate |
| SMILES | CCCNC(=O)C1C(c2ccccc2)C(C(=O)OC)C(c2ccccc2)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H30N2O5S/c1-3-19-29-27(31)26-23(20-13-7-4-8-14-20)24(28(32)35-2)25(21-15-9-5-10-16-21)30(26)36(33,34)22-17-11-6-12-18-22/h4-18,23-26H,3,19H2,1-2H3,(H,29,31) |
| InChIKey | OFSZNFZNBICZPJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate?
The IUPAC name of methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate (CID 23884185) is methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate.
What is the SMILES notation for methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate?
The canonical SMILES for methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate is CCCNC(=O)C1C(c2ccccc2)C(C(=O)OC)C(c2ccccc2)N1S(=O)(=O)c1ccccc1.
What is the InChIKey of methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate?
The InChIKey is OFSZNFZNBICZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N2O5S/c1-3-19-29-27(31)26-23(20-13-7-4-8-14-20)24(28(32)35-2)25(21-15-9-5-10-16-21)30(26)36(33,34)22-17-11-6-12-18-22/h4-18,23-26H,3,19H2,1-2H3,(H,29,31).
What are the key properties of methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate?
methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate has a molecular weight of 506.62 g/mol, XLogP of 3.90, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(benzenesulfonyl)-2,4-diphenyl-5-(propylcarbamoyl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 23884185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).