C14H13NO4S2 — CID 23884716
methyl 7-(4-hydroxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate (PubChem CID 23884716) has the molecular formula C14H13NO4S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is methyl 7-(4-hydroxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate.
| Compound Name | methyl 7-(4-hydroxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 23884716 |
| Molecular Formula | C14H13NO4S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | methyl 7-(4-hydroxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
| SMILES | COC(=O)C1CSc2[nH]c(=O)sc2C1c1ccc(O)cc1 |
| InChI | InChI=1S/C14H13NO4S2/c1-19-13(17)9-6-20-12-11(21-14(18)15-12)10(9)7-2-4-8(16)5-3-7/h2-5,9-10,16H,6H2,1H3,(H,15,18) |
| InChIKey | FPIMRZVYNMCOAD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|