C22H17Cl3N2O3 — CID 23884896
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 23884896) has the molecular formula C22H17Cl3N2O3 and a molecular weight of 463.75 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 23884896 |
| Molecular Formula | C22H17Cl3N2O3 |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | O=C(COC(=O)c1c2c(nc3ccccc13)CCCC2)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl3N2O3/c23-14-9-16(25)19(10-15(14)24)27-20(28)11-30-22(29)21-12-5-1-3-7-17(12)26-18-8-4-2-6-13(18)21/h1,3,5,7,9-10H,2,4,6,8,11H2,(H,27,28) |
| InChIKey | RJTGQRWBFJDSHT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|