C19H19N3S2 — CID 23884932
3-(2,3-dihydroinden-1-ylideneamino)-N-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23884932) has the molecular formula C19H19N3S2 and a molecular weight of 353.52 g/mol. Its IUPAC name is 3-(2,3-dihydroinden-1-ylideneamino)-N-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-(2,3-dihydroinden-1-ylideneamino)-N-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23884932 |
| Molecular Formula | C19H19N3S2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 3-(2,3-dihydroinden-1-ylideneamino)-N-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(C)/N=c1\scc(-c2cccs2)n1N=C1CCc2ccccc21 |
| InChI | InChI=1S/C19H19N3S2/c1-13(2)20-19-22(17(12-24-19)18-8-5-11-23-18)21-16-10-9-14-6-3-4-7-15(14)16/h3-8,11-13H,9-10H2,1-2H3/b20-19-,21-16? |
| InChIKey | VXNRBLUBDWTAPU-WKFFZEIPSA-N |
| XLogP | 4.79 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|