C20H8Cl4N2O6S — CID 23885144
4,5,6,7-tetrachloro-2-[4-(4-nitrophenyl)sulfonylphenyl]isoindole-1,3-dione (PubChem CID 23885144) has the molecular formula C20H8Cl4N2O6S and a molecular weight of 546.17 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[4-(4-nitrophenyl)sulfonylphenyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[4-(4-nitrophenyl)sulfonylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23885144 |
| Molecular Formula | C20H8Cl4N2O6S |
| Molecular Weight | 546.17 g/mol |
| Exact Mass | 543.89 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[4-(4-nitrophenyl)sulfonylphenyl]isoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1c1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H8Cl4N2O6S/c21-15-13-14(16(22)18(24)17(15)23)20(28)25(19(13)27)9-1-5-11(6-2-9)33(31,32)12-7-3-10(4-8-12)26(29)30/h1-8H |
| InChIKey | WRUIVFCFDATVKS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.17 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|